Difference between revisions of "CPD-3725"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLX-tRNAs == * common-name: ** a trnaglx == Reaction(s) known to consume the compound == * 6.1.1.24-RXN == Reaction(s) known to produ...") |
(Created page with "Category:metabolite == Metabolite CPD-3725 == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) * inchi-...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3725 == |
* common-name: | * common-name: | ||
| − | ** | + | ** uridine 2'3'-cyclic monophosphate |
| + | * smiles: | ||
| + | ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) | ||
| + | * inchi-key: | ||
| + | ** hwdmhjdymfrxox-xvfcmesisa-m | ||
| + | * molecular-weight: | ||
| + | ** 305.16 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12060]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=uridine 2'3'-cyclic monophosphate}} |
| + | {{#set: inchi-key=inchikey=hwdmhjdymfrxox-xvfcmesisa-m}} | ||
| + | {{#set: molecular-weight=305.16}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-3725
- common-name:
- uridine 2'3'-cyclic monophosphate
- smiles:
- c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23)))
- inchi-key:
- hwdmhjdymfrxox-xvfcmesisa-m
- molecular-weight:
- 305.16
