Difference between revisions of "CPD-3725"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13150 == * transcription-direction: ** positive * right-end-position: ** 262058 * left-end-position: ** 245163 * centisome-position: ** 71.01995...") |
(Created page with "Category:metabolite == Metabolite CPD-3725 == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) * inchi-...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-3725 == |
| − | * | + | * common-name: |
| − | ** | + | ** uridine 2'3'-cyclic monophosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** hwdmhjdymfrxox-xvfcmesisa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 305.16 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-12060]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=uridine 2'3'-cyclic monophosphate}} | |
| − | + | {{#set: inchi-key=inchikey=hwdmhjdymfrxox-xvfcmesisa-m}} | |
| − | + | {{#set: molecular-weight=305.16}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-3725
- common-name:
- uridine 2'3'-cyclic monophosphate
- smiles:
- c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23)))
- inchi-key:
- hwdmhjdymfrxox-xvfcmesisa-m
- molecular-weight:
- 305.16
