Difference between revisions of "CPD-374"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3481 == * common-name: ** bupropion * smiles: ** cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** snppwiuozrmyny-uhfffaoysa-o *...") |
(Created page with "Category:metabolite == Metabolite LEU == * common-name: ** l-leucine * smiles: ** cc(cc([n+])c([o-])=o)c * inchi-key: ** rohfnlrqfuqhch-yfkpbyrvsa-n * molecular-weight: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LEU == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-leucine |
* smiles: | * smiles: | ||
| − | ** cc([n+] | + | ** cc(cc([n+])c([o-])=o)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rohfnlrqfuqhch-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 131.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]] |
| + | * [[LEUCINE--TRNA-LIGASE-RXN]] | ||
| + | * [[RXN-16293]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]] | ||
| + | * [[RXN0-6979]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-leucine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rohfnlrqfuqhch-yfkpbyrvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=131.174}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite LEU
- common-name:
- l-leucine
- smiles:
- cc(cc([n+])c([o-])=o)c
- inchi-key:
- rohfnlrqfuqhch-yfkpbyrvsa-n
- molecular-weight:
- 131.174
