Difference between revisions of "CPD-374"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LEU == * common-name: ** l-leucine * smiles: ** cc(cc([n+])c([o-])=o)c * inchi-key: ** rohfnlrqfuqhch-yfkpbyrvsa-n * molecular-weight: **...") |
(Created page with "Category:metabolite == Metabolite CPD-374 == * common-name: ** sepiapterin * smiles: ** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2)) * inchi-key: ** vpvoxuspxfpwbn-vkhmyheasa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-374 == |
* common-name: | * common-name: | ||
| − | ** | + | ** sepiapterin |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vpvoxuspxfpwbn-vkhmyheasa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 237.218 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[SEPIAPTERIN-REDUCTASE-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[SEPIAPTERIN-REDUCTASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sepiapterin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vpvoxuspxfpwbn-vkhmyheasa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=237.218}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-374
- common-name:
- sepiapterin
- smiles:
- cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2))
- inchi-key:
- vpvoxuspxfpwbn-vkhmyheasa-n
- molecular-weight:
- 237.218
