Difference between revisions of "CPD-3766"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine65 == * common-name: ** a pseudouridine65 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite CPD-3766 == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) * inchi-key: ** mjvavzpdrwsrrc-uhfffaoysa-n * molecula...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-pseudouridine65 ==
+
== Metabolite CPD-3766 ==
 
* common-name:
 
* common-name:
** a pseudouridine65 in trna
+
** menadione
 +
* smiles:
 +
** cc2(=cc(c1(c=cc=cc=1c2=o))=o)
 +
* inchi-key:
 +
** mjvavzpdrwsrrc-uhfffaoysa-n
 +
* molecular-weight:
 +
** 172.183
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[NADH-DEHYDROGENASE-QUINONE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11840]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a pseudouridine65 in trna}}
+
{{#set: common-name=menadione}}
 +
{{#set: inchi-key=inchikey=mjvavzpdrwsrrc-uhfffaoysa-n}}
 +
{{#set: molecular-weight=172.183}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-3766

  • common-name:
    • menadione
  • smiles:
    • cc2(=cc(c1(c=cc=cc=1c2=o))=o)
  • inchi-key:
    • mjvavzpdrwsrrc-uhfffaoysa-n
  • molecular-weight:
    • 172.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality