Difference between revisions of "CPD-3766"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine65 == * common-name: ** a pseudouridine65 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite CPD-17370 == * common-name: ** 18-hydroxyoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-pseudouridine65 ==
+
== Metabolite CPD-17370 ==
 
* common-name:
 
* common-name:
** a pseudouridine65 in trna
+
** 18-hydroxyoleoyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** mqacsuxwiyyzak-utnxwdcosa-j
 +
* molecular-weight:
 +
** 1043.952
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16117]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11840]]
+
* [[RXN-16402]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a pseudouridine65 in trna}}
+
{{#set: common-name=18-hydroxyoleoyl-coa}}
 +
{{#set: inchi-key=inchikey=mqacsuxwiyyzak-utnxwdcosa-j}}
 +
{{#set: molecular-weight=1043.952}}

Revision as of 15:24, 5 January 2021

Metabolite CPD-17370

  • common-name:
    • 18-hydroxyoleoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • mqacsuxwiyyzak-utnxwdcosa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality