Difference between revisions of "CPD-3766"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00941 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.2.1.39-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-3766 == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) * inchi-key: ** mjvavzpdrwsrrc-uhfffaoysa-n * molecula...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-3766 == |
| − | == | + | * common-name: |
| − | * | + | ** menadione |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) |
| − | + | * inchi-key: | |
| − | + | ** mjvavzpdrwsrrc-uhfffaoysa-n | |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 172.183 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[NADH-DEHYDROGENASE-QUINONE-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=menadione}} | ||
| + | {{#set: inchi-key=inchikey=mjvavzpdrwsrrc-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=172.183}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-3766
- common-name:
- menadione
- smiles:
- cc2(=cc(c1(c=cc=cc=1c2=o))=o)
- inchi-key:
- mjvavzpdrwsrrc-uhfffaoysa-n
- molecular-weight:
- 172.183
