Difference between revisions of "CPD-380"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATESYNTH-RXN DIHYDROFOLATESYNTH-RXN] == * direction: ** left-to-right * common-name: ** d...")
(Created page with "Category:metabolite == Metabolite CPD-380 == * common-name: ** 3-sulfopyruvate * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] * inchi-key: ** buthmsuebypmkj-uhfffaoysa-l * mo...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATESYNTH-RXN DIHYDROFOLATESYNTH-RXN] ==
+
== Metabolite CPD-380 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** dihydrofolate synthetase
+
** 3-sulfopyruvate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.3.2.12 ec-6.3.2.12]
+
** c(=o)([o-])c(=o)cs(=o)(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[7-8-DIHYDROPTEROATE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[GLT]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[DIHYDROFOLATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
+
** buthmsuebypmkj-uhfffaoysa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17018]]
+
** 166.105
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[R230-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-11737]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[R230-RXN]]
−
== Pathway(s) ==
+
* [[RXN-11737]]
−
* [[PWY-6614]], tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6614 PWY-6614]
+
== Reaction(s) of unknown directionality ==
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
{{#set: common-name=3-sulfopyruvate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=buthmsuebypmkj-uhfffaoysa-l}}
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=166.105}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23585 23585]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02237 R02237]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q9JVC6 Q9JVC6]
 
−
** [http://www.uniprot.org/uniprot/P43775 P43775]
 
−
** [http://www.uniprot.org/uniprot/Q9PNK6 Q9PNK6]
 
−
** [http://www.uniprot.org/uniprot/Q50990 Q50990]
 
−
** [http://www.uniprot.org/uniprot/P08192 P08192]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=dihydrofolate synthetase}}
 
−
{{#set: ec-number=ec-6.3.2.12}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-380

  • common-name:
    • 3-sulfopyruvate
  • smiles:
    • c(=o)([o-])c(=o)cs(=o)(=o)[o-]
  • inchi-key:
    • buthmsuebypmkj-uhfffaoysa-l
  • molecular-weight:
    • 166.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-380&oldid=139058"