Difference between revisions of "CPD-380"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-4-aminobutylidene-eIF5A-lysine == * common-name: ** an [eif5a-precursor]-n-(4-aminobutylidene)-lysine == Reaction(s) known to consume t...") |
(Created page with "Category:metabolite == Metabolite CPD-380 == * common-name: ** 3-sulfopyruvate * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] * inchi-key: ** buthmsuebypmkj-uhfffaoysa-l * mo...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-380 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-sulfopyruvate |
| + | * smiles: | ||
| + | ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** buthmsuebypmkj-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 166.105 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[R230-RXN]] |
| + | * [[RXN-11737]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[R230-RXN]] |
| + | * [[RXN-11737]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-sulfopyruvate}} |
| + | {{#set: inchi-key=inchikey=buthmsuebypmkj-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=166.105}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-380
- common-name:
- 3-sulfopyruvate
- smiles:
- c(=o)([o-])c(=o)cs(=o)(=o)[o-]
- inchi-key:
- buthmsuebypmkj-uhfffaoysa-l
- molecular-weight:
- 166.105
