Difference between revisions of "CPD-381"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18425 == * transcription-direction: ** positive * right-end-position: ** 108754 * left-end-position: ** 97682 * centisome-position: ** 39.59113...") |
(Created page with "Category:metabolite == Metabolite CPD0-2121 == * common-name: ** trans-hex-2-enoyl-coa * smiles: ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD0-2121 == |
− | * | + | * common-name: |
− | ** | + | ** trans-hex-2-enoyl-coa |
− | + | * smiles: | |
− | + | ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | + | * inchi-key: | |
− | * | + | ** oinxhibnzuuimr-ixuyqxaasa-j |
− | + | * molecular-weight: | |
− | ** | + | ** 859.631 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[ECOAH2h]] | |
− | = | + | * [[RXN-12559]] |
− | + | * [[RXN-14278]] | |
− | * | + | * [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]] |
− | ** | + | == Reaction(s) known to produce the compound == |
− | + | * [[ECOAH2h]] | |
− | * | + | * [[RXN-12567]] |
− | ** | + | * [[RXN-14278]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=trans-hex-2-enoyl-coa}} |
− | * | + | {{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}} |
− | * [[RXN- | + | {{#set: molecular-weight=859.631}} |
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD0-2121
- common-name:
- trans-hex-2-enoyl-coa
- smiles:
- cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- oinxhibnzuuimr-ixuyqxaasa-j
- molecular-weight:
- 859.631