Difference between revisions of "CPD-388"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2961 == * common-name: ** d-gluconate 6-phosphate * smiles: ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o * inchi-key: ** birsgzkfk...") |
(Created page with "Category:metabolite == Metabolite CPD0-1107 == * common-name: ** β-l-fucopyranose * smiles: ** cc1(oc(c(c(c1o)o)o)o) * inchi-key: ** shzgcjcmobcmkk-kgjvwpdlsa-n * mol...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-1107 == |
* common-name: | * common-name: | ||
− | ** | + | ** β-l-fucopyranose |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(oc(c(c(c1o)o)o)o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** shzgcjcmobcmkk-kgjvwpdlsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 164.158 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-5298]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-5298]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=β-l-fucopyranose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=shzgcjcmobcmkk-kgjvwpdlsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=164.158}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite CPD0-1107
- common-name:
- β-l-fucopyranose
- smiles:
- cc1(oc(c(c(c1o)o)o)o)
- inchi-key:
- shzgcjcmobcmkk-kgjvwpdlsa-n
- molecular-weight:
- 164.158