Difference between revisions of "CPD-388"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CTP == * common-name: ** ctp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2)) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-388 == * common-name: ** pentadecanal * smiles: ** cccccccccccccc[ch]=o * inchi-key: ** xgqjzncfdlxsij-uhfffaoysa-n * molecular-weigh...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-388 == |
* common-name: | * common-name: | ||
− | ** | + | ** pentadecanal |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccccccccc[ch]=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xgqjzncfdlxsij-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 226.401 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[FATTY-ACID-PEROXIDASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pentadecanal}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xgqjzncfdlxsij-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=226.401}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-388
- common-name:
- pentadecanal
- smiles:
- cccccccccccccc[ch]=o
- inchi-key:
- xgqjzncfdlxsij-uhfffaoysa-n
- molecular-weight:
- 226.401