Difference between revisions of "CPD-388"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2961 == * common-name: ** d-gluconate 6-phosphate * smiles: ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o * inchi-key: ** birsgzkfk...") |
(Created page with "Category:metabolite == Metabolite CPD-388 == * common-name: ** pentadecanal * smiles: ** cccccccccccccc[ch]=o * inchi-key: ** xgqjzncfdlxsij-uhfffaoysa-n * molecular-weigh...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-388 == |
* common-name: | * common-name: | ||
| − | ** | + | ** pentadecanal |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccc[ch]=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xgqjzncfdlxsij-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 226.401 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[FATTY-ACID-PEROXIDASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pentadecanal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xgqjzncfdlxsij-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=226.401}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-388
- common-name:
- pentadecanal
- smiles:
- cccccccccccccc[ch]=o
- inchi-key:
- xgqjzncfdlxsij-uhfffaoysa-n
- molecular-weight:
- 226.401
