Difference between revisions of "CPD-396"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19170 == * common-name: ** (2e,7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...")
(Created page with "Category:metabolite == Metabolite Guanine26-in-tRNA == * common-name: ** a guanine26 in trna == Reaction(s) known to consume the compound == * RXN-12375 * [[RXN-12377]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19170 ==
+
== Metabolite Guanine26-in-tRNA ==
 
* common-name:
 
* common-name:
** (2e,7z)-hexadecenoyl-coa
+
** a guanine26 in trna
* smiles:
 
** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** yqarrkbgbkpbcx-dvzfgldusa-j
 
* molecular-weight:
 
** 997.883
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17780]]
+
* [[RXN-12375]]
 +
* [[RXN-12377]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17779]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,7z)-hexadecenoyl-coa}}
+
{{#set: common-name=a guanine26 in trna}}
{{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}}
 
{{#set: molecular-weight=997.883}}
 

Revision as of 11:13, 15 January 2021

Metabolite Guanine26-in-tRNA

  • common-name:
    • a guanine26 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality