Difference between revisions of "CPD-396"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10627 == * transcription-direction: ** positive * right-end-position: ** 92463 * left-end-position: ** 86041 * centisome-position: ** 22.226097...") |
(Created page with "Category:metabolite == Metabolite CPD-396 == * common-name: ** 1-methylnicotinamide * smiles: ** c[n+]1(=cc=cc(=c1)c(=o)n) * inchi-key: ** ldhmavipbrsvrg-uhfffaoysa-o * mo...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-396 == |
| − | * | + | * common-name: |
| − | ** | + | ** 1-methylnicotinamide |
| − | * | + | * smiles: |
| − | ** | + | ** c[n+]1(=cc=cc(=c1)c(=o)n) |
| − | * | + | * inchi-key: |
| − | ** | + | ** ldhmavipbrsvrg-uhfffaoysa-o |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 137.161 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=1-methylnicotinamide}} | |
| − | + | {{#set: inchi-key=inchikey=ldhmavipbrsvrg-uhfffaoysa-o}} | |
| − | + | {{#set: molecular-weight=137.161}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-396
- common-name:
- 1-methylnicotinamide
- smiles:
- c[n+]1(=cc=cc(=c1)c(=o)n)
- inchi-key:
- ldhmavipbrsvrg-uhfffaoysa-o
- molecular-weight:
- 137.161
