|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14025 RXN-14025] == | + | == Metabolite CPD-403 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** ump phosphatase | + | ** 3-hydroxy-4-methylanthranilate |
| − | ** 5'-nucleotidase
| + | * smiles: |
| − | * ec-number: | + | ** cc1(=cc=c(c(=c1o)n)c([o-])=o) |
| − | ** [http://enzyme.expasy.org/EC/3.1.3.5 ec-3.1.3.5] | + | * inchi-key: |
| − | == Reaction formula ==
| + | ** oyzonaxdawhdmn-uhfffaoysa-m |
| − | * 1 [[UMP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[URIDINE]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 166.156 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ15366]]
| + | * [[RXN-17077]] |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-17077]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=3-hydroxy-4-methylanthranilate}} |
| − | * Gene: [[SJ18895]]
| + | {{#set: inchi-key=inchikey=oyzonaxdawhdmn-uhfffaoysa-m}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=166.156}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ16098]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ09030]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ18402]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-7821]], tunicamycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7821 PWY-7821] | |
| − | ** '''2''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7185]], UTP and CTP dephosphorylation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7185 PWY-7185]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29360 29360]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=ump phosphatase|5'-nucleotidase}} | |
| − | {{#set: ec-number=ec-3.1.3.5}}
| |
| − | {{#set: nb gene associated=5}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
| |
