Difference between revisions of "CPD-405"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-Alkyl-glycerol-3-phosphate == * common-name: ** a 1-alkyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * R...") |
(Created page with "Category:metabolite == Metabolite CPD-8120 == * common-name: ** di-homo-γ-linolenate * smiles: ** cccccc=ccc=ccc=cccccccc(=o)[o-] * inchi-key: ** hobaelrkjckhqd-qneb...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8120 == |
* common-name: | * common-name: | ||
| − | ** | + | ** di-homo-γ-linolenate |
| + | * smiles: | ||
| + | ** cccccc=ccc=ccc=cccccccc(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** hobaelrkjckhqd-qnebeihssa-m | ||
| + | * molecular-weight: | ||
| + | ** 305.479 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13435]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=di-homo-γ-linolenate}} |
| + | {{#set: inchi-key=inchikey=hobaelrkjckhqd-qnebeihssa-m}} | ||
| + | {{#set: molecular-weight=305.479}} | ||
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-8120
- common-name:
- di-homo-γ-linolenate
- smiles:
- cccccc=ccc=ccc=cccccccc(=o)[o-]
- inchi-key:
- hobaelrkjckhqd-qnebeihssa-m
- molecular-weight:
- 305.479
