Difference between revisions of "CPD-405"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8120 == * common-name: ** di-homo-γ-linolenate * smiles: ** cccccc=ccc=ccc=cccccccc(=o)[o-] * inchi-key: ** hobaelrkjckhqd-qneb...") |
(Created page with "Category:metabolite == Metabolite Glycerophosphodiesters == * common-name: ** a glycerophosphodiester == Reaction(s) known to consume the compound == * [[GLYCPDIESTER-RXN]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Glycerophosphodiesters == |
* common-name: | * common-name: | ||
| − | ** | + | ** a glycerophosphodiester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLYCPDIESTER-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a glycerophosphodiester}} |
| − | |||
| − | |||
Revision as of 18:55, 14 January 2021
Contents
Metabolite Glycerophosphodiesters
- common-name:
- a glycerophosphodiester
