Difference between revisions of "CPD-4101"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14528 == * transcription-direction: ** positive * right-end-position: ** 436505 * left-end-position: ** 415962 * centisome-position: ** 58.36941...")
(Created page with "Category:metabolite == Metabolite CPD-8120 == * common-name: ** di-homo-γ-linolenate * smiles: ** cccccc=ccc=ccc=cccccccc(=o)[o-] * inchi-key: ** hobaelrkjckhqd-qneb...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14528 ==
+
== Metabolite CPD-8120 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** di-homo-γ-linolenate
−
* right-end-position:
+
* smiles:
−
** 436505
+
** cccccc=ccc=ccc=cccccccc(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 415962
+
** hobaelrkjckhqd-qnebeihssa-m
−
* centisome-position:
+
* molecular-weight:
−
** 58.36941   
+
** 305.479
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-13435]]
−
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=di-homo-γ-linolenate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hobaelrkjckhqd-qnebeihssa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=305.479}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[ACOACXr]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[BIOTIN-CARBOXYL-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5055]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7388]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6679]]
 
−
** '''1''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5744]]
 
−
** '''4''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-5743]]
 
−
** '''5''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-5789]]
 
−
** '''8''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY0-1264]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6722]]
 
−
** '''1''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-4381]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=436505}}
 
−
{{#set: left-end-position=415962}}
 
−
{{#set: centisome-position=58.36941    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=8}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-8120

  • common-name:
    • di-homo-γ-linolenate
  • smiles:
    • cccccc=ccc=ccc=cccccccc(=o)[o-]
  • inchi-key:
    • hobaelrkjckhqd-qnebeihssa-m
  • molecular-weight:
    • 305.479

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4101&oldid=46922"