Difference between revisions of "CPD-4101"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17858 == * common-name: ** ω-saturated c55 dolichol phosphate * smiles: ** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite Delta7-Steroids == * common-name: ** a δ7-sterol == Reaction(s) known to consume the compound == * RXN-16378 == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17858 ==
+
== Metabolite Delta7-Steroids ==
 
* common-name:
 
* common-name:
** ω-saturated c55 dolichol phosphate
+
** a δ7-sterol
* smiles:
 
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])[o-])c
 
* inchi-key:
 
** ktgsdhzxakcyhm-lstwdcehsa-l
 
* molecular-weight:
 
** 849.311
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16602]]
+
* [[RXN-16378]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16378]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ω-saturated c55 dolichol phosphate}}
+
{{#set: common-name=a δ7-sterol}}
{{#set: inchi-key=inchikey=ktgsdhzxakcyhm-lstwdcehsa-l}}
 
{{#set: molecular-weight=849.311}}
 

Revision as of 15:27, 5 January 2021

Metabolite Delta7-Steroids

  • common-name:
    • a δ7-sterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality