Difference between revisions of "CPD-4124"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03499 == * transcription-direction: ** positive * right-end-position: ** 21430 * left-end-position: ** 10941 * centisome-position: ** 9.114993...") |
(Created page with "Category:metabolite == Metabolite HIS == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key: ** hndvdqjcigzpno-yfkpbyrvsa-n * molecular-we...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite HIS == |
| − | * | + | * common-name: |
| − | ** | + | ** l-histidine |
| − | * | + | * smiles: |
| − | ** | + | ** c1(nc=nc=1cc(c(=o)[o-])[n+]) |
| − | * | + | * inchi-key: |
| − | ** | + | ** hndvdqjcigzpno-yfkpbyrvsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 155.156 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[HISTIDINE--TRNA-LIGASE-RXN]] |
| − | == Reaction(s) | + | * [[HISTIDINE-AMMONIA-LYASE-RXN]] |
| − | * [[ | + | * [[HISTIDINE-DECARBOXYLASE-RXN]] |
| − | * | + | * [[biomass_rxn]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[HISTALDEHYD-RXN]] |
| − | {{#set: | + | * [[RXN-8001]] |
| − | + | * [[RXN0-6978]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=l-histidine}} | |
| − | + | {{#set: inchi-key=inchikey=hndvdqjcigzpno-yfkpbyrvsa-n}} | |
| + | {{#set: molecular-weight=155.156}} | ||
Revision as of 20:31, 18 December 2020
Contents
Metabolite HIS
- common-name:
- l-histidine
- smiles:
- c1(nc=nc=1cc(c(=o)[o-])[n+])
- inchi-key:
- hndvdqjcigzpno-yfkpbyrvsa-n
- molecular-weight:
- 155.156
