Difference between revisions of "CPD-4124"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HIS == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key: ** hndvdqjcigzpno-yfkpbyrvsa-n * molecular-we...") |
(Created page with "Category:metabolite == Metabolite CPD-387 == * common-name: ** iodide * smiles: ** [i-] * inchi-key: ** xmbwdfgmswqbca-uhfffaoysa-m * molecular-weight: ** 126.904 == React...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-387 == |
* common-name: | * common-name: | ||
| − | ** | + | ** iodide |
* smiles: | * smiles: | ||
| − | ** | + | ** [i-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xmbwdfgmswqbca-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 126.904 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11241]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=iodide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xmbwdfgmswqbca-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=126.904}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-387
- common-name:
- iodide
- smiles:
- [i-]
- inchi-key:
- xmbwdfgmswqbca-uhfffaoysa-m
- molecular-weight:
- 126.904
