Difference between revisions of "CPD-4126"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-396 == * common-name: ** 1-methylnicotinamide * smiles: ** c[n+]1(=cc=cc(=c1)c(=o)n) * inchi-key: ** ldhmavipbrsvrg-uhfffaoysa-o * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-4126 == * common-name: ** 5-dehydroavenasterol * smiles: ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-4126 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-dehydroavenasterol |
* smiles: | * smiles: | ||
| − | ** c[ | + | ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xprwwanupmykmf-hvegqnehsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 410.682 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-4210]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-4209]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-dehydroavenasterol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xprwwanupmykmf-hvegqnehsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=410.682}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-4126
- common-name:
- 5-dehydroavenasterol
- smiles:
- cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- xprwwanupmykmf-hvegqnehsa-n
- molecular-weight:
- 410.682
