Difference between revisions of "CPD-415"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16825 == * common-name: ** (s)-equol 4'-sulfate * smiles: ** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite CPD-415 == * common-name: ** a 1-long-chain acyl-glycerone 3-phosphate == Reaction(s) known to consume the compound == * ALKYLGLYCERONE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16825 ==
+
== Metabolite CPD-415 ==
 
* common-name:
 
* common-name:
** (s)-equol 4'-sulfate
+
** a 1-long-chain acyl-glycerone 3-phosphate
* smiles:
 
** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o)
 
* inchi-key:
 
** uxojwgsgkuymia-gfccvegcsa-m
 
* molecular-weight:
 
** 321.324
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15589]]
+
* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15589]]
+
* [[2.3.1.42-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-equol 4'-sulfate}}
+
{{#set: common-name=a 1-long-chain acyl-glycerone 3-phosphate}}
{{#set: inchi-key=inchikey=uxojwgsgkuymia-gfccvegcsa-m}}
 
{{#set: molecular-weight=321.324}}
 

Revision as of 18:58, 14 January 2021

Metabolite CPD-415

  • common-name:
    • a 1-long-chain acyl-glycerone 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality