Difference between revisions of "CPD-415"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16825 == * common-name: ** (s)-equol 4'-sulfate * smiles: ** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-415 == * common-name: ** a 1-long-chain acyl-glycerone 3-phosphate == Reaction(s) known to consume the compound == * ALKYLGLYCERONE...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-415 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 1-long-chain acyl-glycerone 3-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[2.3.1.42-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 1-long-chain acyl-glycerone 3-phosphate}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-415
- common-name:
- a 1-long-chain acyl-glycerone 3-phosphate