Difference between revisions of "CPD-4162"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15036 == * common-name: ** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate * smiles: ** c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-] * inchi-k...")
(Created page with "Category:metabolite == Metabolite CPD0-2474 == * common-name: ** (s)-nadphx * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15036 ==
+
== Metabolite CPD0-2474 ==
 
* common-name:
 
* common-name:
** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate
+
** (s)-nadphx
 
* smiles:
 
* smiles:
** c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-]
+
** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
 
* inchi-key:
 
* inchi-key:
** wfkzeqzrfipkif-ucorvyfpsa-l
+
** szkxtjuokargiy-vphrtnkssa-j
 
* molecular-weight:
 
* molecular-weight:
** 254.168
+
** 759.41
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13139]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14021]]
+
* [[RXN-13139]]
 +
* [[RXN-13142]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate}}
+
{{#set: common-name=(s)-nadphx}}
{{#set: inchi-key=inchikey=wfkzeqzrfipkif-ucorvyfpsa-l}}
+
{{#set: inchi-key=inchikey=szkxtjuokargiy-vphrtnkssa-j}}
{{#set: molecular-weight=254.168}}
+
{{#set: molecular-weight=759.41}}

Revision as of 08:29, 15 March 2021

Metabolite CPD0-2474

  • common-name:
    • (s)-nadphx
  • smiles:
    • c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
  • inchi-key:
    • szkxtjuokargiy-vphrtnkssa-j
  • molecular-weight:
    • 759.41

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality