Difference between revisions of "CPD-419"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13613 == * common-name: ** l-threo-sphinganine * smiles: ** cccccccccccccccc(c(co)[n+])o * inchi-key: ** otkjdmgtuttymp-rouuacijsa-o...") |
(Created page with "Category:metabolite == Metabolite DELTA-TOCOPHEROL == * common-name: ** δ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DELTA-TOCOPHEROL == |
* common-name: | * common-name: | ||
| − | ** | + | ** δ-tocopherol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gzifeoyasatjeh-vhfrwlagsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 402.659 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-2562]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=δ-tocopherol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gzifeoyasatjeh-vhfrwlagsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=402.659}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite DELTA-TOCOPHEROL
- common-name:
- δ-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c))
- inchi-key:
- gzifeoyasatjeh-vhfrwlagsa-n
- molecular-weight:
- 402.659
