Difference between revisions of "CPD-419"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DELTA-TOCOPHEROL == * common-name: ** δ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite UREA == * common-name: ** urea * smiles: ** c(=o)(n)n * inchi-key: ** xsqukjjjfzcrtk-uhfffaoysa-n * molecular-weight: ** 60.055 == Reacti...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UREA == |
* common-name: | * common-name: | ||
− | ** | + | ** urea |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)(n)n |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xsqukjjjfzcrtk-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 60.055 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ARGINASE-RXN]] |
+ | * [[TRANS-RXN0-460]] | ||
+ | * [[UREASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[AGMATIN-RXN]] | ||
+ | * [[ALLANTOICASE-RXN]] | ||
+ | * [[ARGINASE-RXN]] | ||
+ | * [[CREATINASE-RXN]] | ||
+ | * [[RXN-34]] | ||
+ | * [[TRANS-RXN0-460]] | ||
+ | * [[UREASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=urea}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xsqukjjjfzcrtk-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=60.055}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite UREA
- common-name:
- urea
- smiles:
- c(=o)(n)n
- inchi-key:
- xsqukjjjfzcrtk-uhfffaoysa-n
- molecular-weight:
- 60.055