Difference between revisions of "CPD-4201"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-5AminoMe-2-ThioUrdines == * common-name: ** a 5-aminomethyl-2-thiouridine34 in trna == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite CPD-4201 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-4201 == |
* common-name: | * common-name: | ||
− | ** | + | ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate |
+ | * smiles: | ||
+ | ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c | ||
+ | * inchi-key: | ||
+ | ** oplvztyvquwkhb-sdbhatresa-k | ||
+ | * molecular-weight: | ||
+ | ** 572.278 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-4303]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-triphosphate}} |
+ | {{#set: inchi-key=inchikey=oplvztyvquwkhb-sdbhatresa-k}} | ||
+ | {{#set: molecular-weight=572.278}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-4201
- common-name:
- n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
- smiles:
- cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
- inchi-key:
- oplvztyvquwkhb-sdbhatresa-k
- molecular-weight:
- 572.278