Difference between revisions of "CPD-4201"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18392 == * transcription-direction: ** negative * right-end-position: ** 108445 * left-end-position: ** 74680 * centisome-position: ** 30.214268...")
(Created page with "Category:metabolite == Metabolite CPD-4201 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18392 ==
+
== Metabolite CPD-4201 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
−
* right-end-position:
+
* smiles:
−
** 108445
+
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
−
* left-end-position:
+
* inchi-key:
−
** 74680
+
** oplvztyvquwkhb-sdbhatresa-k
−
* centisome-position:
+
* molecular-weight:
−
** 30.214268   
+
** 572.278
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-4303]]
−
* [[3.1.3.16-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-triphosphate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=oplvztyvquwkhb-sdbhatresa-k}}
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: molecular-weight=572.278}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10958]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6368]]
 
−
** '''6''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6580]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6367]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=108445}}
 
−
{{#set: left-end-position=74680}}
 
−
{{#set: centisome-position=30.214268    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-4201

  • common-name:
    • n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
  • smiles:
    • cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
  • inchi-key:
    • oplvztyvquwkhb-sdbhatresa-k
  • molecular-weight:
    • 572.278

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4201&oldid=137031"