Difference between revisions of "CPD-4203"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00780 == * transcription-direction: ** positive * right-end-position: ** 42185 * left-end-position: ** 15261 * centisome-position: ** 9.450237...")
(Created page with "Category:metabolite == Metabolite CPD-14706 == * common-name: ** 4-hydroxy-2-nonenal-[l-cys] conjugate * smiles: ** cccccc(o)c(cc=o)scc([n+])c(=o)[o-] * inchi-key: ** salp...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00780 ==
+
== Metabolite CPD-14706 ==
* transcription-direction:
+
* common-name:
** positive
+
** 4-hydroxy-2-nonenal-[l-cys] conjugate
* right-end-position:
+
* smiles:
** 42185
+
** cccccc(o)c(cc=o)scc([n+])c(=o)[o-]
* left-end-position:
+
* inchi-key:
** 15261
+
** salpdushmtyyoh-uhfffaoysa-n
* centisome-position:
+
* molecular-weight:
** 9.450237   
+
** 277.378
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-13677]]
* [[1.2.1.18-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=4-hydroxy-2-nonenal-[l-cys] conjugate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=salpdushmtyyoh-uhfffaoysa-n}}
* [[1.2.1.27-RXN]]
+
{{#set: molecular-weight=277.378}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-11213]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-2902]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-9958]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-5642]]
 
** '''1''' reactions found over '''7''' reactions in the full pathway
 
* [[VALDEG-PWY]]
 
** '''6''' reactions found over '''8''' reactions in the full pathway
 
* [[BETA-ALA-DEGRADATION-I-PWY]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-7574]]
 
** '''3''' reactions found over '''5''' reactions in the full pathway
 
* [[P562-PWY]]
 
** '''2''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-1781]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-6373]]
 
** '''1''' reactions found over '''4''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=42185}}
 
{{#set: left-end-position=15261}}
 
{{#set: centisome-position=9.450237    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=5}}
 
{{#set: nb pathway associated=7}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-14706

  • common-name:
    • 4-hydroxy-2-nonenal-[l-cys] conjugate
  • smiles:
    • cccccc(o)c(cc=o)scc([n+])c(=o)[o-]
  • inchi-key:
    • salpdushmtyyoh-uhfffaoysa-n
  • molecular-weight:
    • 277.378

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "4-hydroxy-2-nonenal-[l-cys] conjugate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.