Difference between revisions of "CPD-4205"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LEU-tRNAs == * common-name: ** a trnaleu == Reaction(s) known to consume the compound == * LEUCINE--TRNA-LIGASE-RXN == Reaction(s) kn...")
(Created page with "Category:metabolite == Metabolite CPD-4205 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LEU-tRNAs ==
+
== Metabolite CPD-4205 ==
 
* common-name:
 
* common-name:
** a trnaleu
+
** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate
 +
* smiles:
 +
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c
 +
* inchi-key:
 +
** duiszflwbaprbr-sdbhatresa-l
 +
* molecular-weight:
 +
** 413.326
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LEUCINE--TRNA-LIGASE-RXN]]
+
* [[RXN-4311]]
 +
* [[RXN-4313]]
 +
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
 +
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-4307]]
 +
* [[RXN-4311]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnaleu}}
+
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-monophosphate}}
 +
{{#set: inchi-key=inchikey=duiszflwbaprbr-sdbhatresa-l}}
 +
{{#set: molecular-weight=413.326}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-4205

  • common-name:
    • n6-(δ2-isopentenyl)-adenosine 5'-monophosphate
  • smiles:
    • cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c
  • inchi-key:
    • duiszflwbaprbr-sdbhatresa-l
  • molecular-weight:
    • 413.326

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality