Difference between revisions of "CPD-4205"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2161 RXN0-2161] == * direction: ** left-to-right * common-name: ** l-serine:trnasec ligase (am...")
(Created page with "Category:metabolite == Metabolite CPD-4205 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2161 RXN0-2161] ==
+
== Metabolite CPD-4205 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** l-serine:trnasec ligase (amp-forming)
+
** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.1.1.11 ec-6.1.1.11]
+
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[SER]][c] '''+''' 1 [[tRNA-Sec]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[L-seryl-SEC-tRNAs]][c] '''+''' 1 [[PPI]][c]
+
** duiszflwbaprbr-sdbhatresa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07311]]
+
** 413.326
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-4311]]
−
** Category: [[orthology]]
+
* [[RXN-4313]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
−
* Gene: [[SJ14143]]
+
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-4307]]
−
** Category: [[orthology]]
+
* [[RXN-4311]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s)  ==
+
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-monophosphate}}
−
* [[PWY0-901]], L-selenocysteine biosynthesis I (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-901 PWY0-901]
+
{{#set: inchi-key=inchikey=duiszflwbaprbr-sdbhatresa-l}}
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
{{#set: molecular-weight=413.326}}
−
* [[PWY-6281]], L-selenocysteine biosynthesis II (archaea and eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6281 PWY-6281]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=42581 42581]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R08218 R08218]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=l-serine:trnasec ligase (amp-forming)}}
 
−
{{#set: ec-number=ec-6.1.1.11}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-4205

  • common-name:
    • n6-(δ2-isopentenyl)-adenosine 5'-monophosphate
  • smiles:
    • cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c
  • inchi-key:
    • duiszflwbaprbr-sdbhatresa-l
  • molecular-weight:
    • 413.326

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4205&oldid=139578"