Difference between revisions of "CPD-4209"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9872 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite CPD1F-140 == * common-name: ** gibberellin a20 * smiles: ** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc2)([ch](cc3)4)5)(c)))c([o-])=o))) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9872 ==
+
== Metabolite CPD1F-140 ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol
+
** gibberellin a20
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c
+
** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc2)([ch](cc3)4)5)(c)))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** glnrsjsltucxtp-iqsnhbbhsa-n
+
** oxfpycsnyofuch-aodvqfrnsa-m
 
* molecular-weight:
 
* molecular-weight:
** 767.229
+
** 331.388
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-113]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9242]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=gibberellin a20}}
{{#set: inchi-key=inchikey=glnrsjsltucxtp-iqsnhbbhsa-n}}
+
{{#set: inchi-key=inchikey=oxfpycsnyofuch-aodvqfrnsa-m}}
{{#set: molecular-weight=767.229}}
+
{{#set: molecular-weight=331.388}}

Revision as of 08:27, 15 March 2021

Metabolite CPD1F-140

  • common-name:
    • gibberellin a20
  • smiles:
    • c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc2)([ch](cc3)4)5)(c)))c([o-])=o)))
  • inchi-key:
    • oxfpycsnyofuch-aodvqfrnsa-m
  • molecular-weight:
    • 331.388

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality