Difference between revisions of "CPD-4209"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-BETA-D-GLUCOSYLGLUCOSE == * common-name: ** nigerose * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2) * inchi-key: ** qig...")
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-BETA-D-GLUCOSYLGLUCOSE ==
+
== Metabolite CPD-4209 ==
 
* common-name:
 
* common-name:
** nigerose
+
** n6-dimethylallyladenine
 
* smiles:
 
* smiles:
** c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2)
+
** cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
 
* inchi-key:
 
* inchi-key:
** qigjyvcqydkydw-nsyytrpssa-n
+
** hyvabzigrdekcd-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 342.299
+
** 203.246
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5395]]
+
* [[1.5.99.12-RXN]]
 +
* [[RXN-4315]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.5.99.12-RXN]]
 +
* [[RXN-4313]]
 +
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
 +
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
 +
* [[RXN-4315]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nigerose}}
+
{{#set: common-name=n6-dimethylallyladenine}}
{{#set: inchi-key=inchikey=qigjyvcqydkydw-nsyytrpssa-n}}
+
{{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}}
{{#set: molecular-weight=342.299}}
+
{{#set: molecular-weight=203.246}}

Latest revision as of 11:14, 18 March 2021