Difference between revisions of "CPD-4209"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-BETA-D-GLUCOSYLGLUCOSE == * common-name: ** nigerose * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2) * inchi-key: ** qig...") |
(Created page with "Category:metabolite == Metabolite Histone-L-lysine == * common-name: ** a [histone]-l-lysine == Reaction(s) known to consume the compound == * HISTONE-ACETYLTRANSFERASE-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Histone-L-lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [histone]-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[HISTONE-ACETYLTRANSFERASE-RXN]] |
| + | * [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.5.1.98-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [histone]-l-lysine}} |
| − | |||
| − | |||
Revision as of 13:10, 14 January 2021
Contents
Metabolite Histone-L-lysine
- common-name:
- a [histone]-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [histone]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
