Difference between revisions of "CPD-4209"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17329 == * transcription-direction: ** positive * right-end-position: ** 130562 * left-end-position: ** 116944 * centisome-position: ** 44.28087...")
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17329 ==
+
== Metabolite CPD-4209 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** n6-dimethylallyladenine
−
* right-end-position:
+
* smiles:
−
** 130562
+
** cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
−
* left-end-position:
+
* inchi-key:
−
** 116944
+
** hyvabzigrdekcd-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 44.28087   
+
** 203.246
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.5.99.12-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-4315]]
−
* [[DIOHBUTANONEPSYN-RXN]]
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
−
** Category: [[annotation]]
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[GTP-CYCLOHYDRO-II-RXN]]
+
* [[1.5.99.12-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-4313]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
−
== Pathway(s) associated ==
+
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
−
* [[RIBOSYN2-PWY]]
+
* [[RXN-4315]]
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
−
* [[PWY-6167]]
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
−
** '''5''' reactions found over '''10''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-6168]]
+
{{#set: common-name=n6-dimethylallyladenine}}
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}}
−
* [[PWY-7539]]
+
{{#set: molecular-weight=203.246}}
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=130562}}
 
−
{{#set: left-end-position=116944}}
 
−
{{#set: centisome-position=44.28087    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-4209

  • common-name:
    • n6-dimethylallyladenine
  • smiles:
    • cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
  • inchi-key:
    • hyvabzigrdekcd-uhfffaoysa-n
  • molecular-weight:
    • 203.246

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4209&oldid=138003"