Difference between revisions of "CPD-4211"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12728 RXN-12728] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-4211 == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] * inchi-key: ** cbidrcwhncksto-...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-4211 == |
| − | * | + | * common-name: |
| − | ** | + | ** dimethylallyl diphosphate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] |
| − | == Reaction | + | * inchi-key: |
| − | * | + | ** cbidrcwhncksto-uhfffaoysa-k |
| − | + | * molecular-weight: | |
| − | * | + | ** 243.069 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[GPPS]] |
| − | * | + | * [[GPPSYN-RXN]] |
| − | == | + | * [[IPPISOM-RXN]] |
| − | * [[ | + | * [[RXN-4303]] |
| − | * | + | * [[RXN-4305]] |
| − | + | * [[RXN-4307]] | |
| − | + | * [[RXN-7810]] | |
| − | == | + | * [[RXN-7811]] |
| − | {{#set: | + | * [[RXN-7813]] |
| − | {{#set: | + | * [[RXN0-6274]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | + | * [[GPPSYN-RXN]] | |
| − | + | * [[IDI]] | |
| − | + | * [[IDS2]] | |
| − | + | * [[IPPISOM-RXN]] | |
| − | + | * [[RXN0-884]] | |
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=dimethylallyl diphosphate}} | ||
| + | {{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}} | ||
| + | {{#set: molecular-weight=243.069}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-4211
- common-name:
- dimethylallyl diphosphate
- smiles:
- cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- cbidrcwhncksto-uhfffaoysa-k
- molecular-weight:
- 243.069
