Difference between revisions of "CPD-4211"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7037 == * common-name: ** methionol * smiles: ** csccco * inchi-key: ** czugfkjycpyhhv-uhfffaoysa-n * molecular-weight: ** 106.182 ==...")
(Created page with "Category:metabolite == Metabolite PROPIONYL-COA == * common-name: ** propanoyl-coa * smiles: ** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7037 ==
+
== Metabolite PROPIONYL-COA ==
 
* common-name:
 
* common-name:
** methionol
+
** propanoyl-coa
 
* smiles:
 
* smiles:
** csccco
+
** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** czugfkjycpyhhv-uhfffaoysa-n
+
** qaqrevbbadehpa-iexphmlfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 106.182
+
** 819.566
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[PPCOAOm]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7706]]
+
* [[1.2.1.27-RXN]]
 +
* [[2.3.1.176-RXN]]
 +
* [[ACCAT]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[PPCOAOm]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[RXN-11213]]
 +
* [[RXN-12561]]
 +
* [[RXN-7790]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methionol}}
+
{{#set: common-name=propanoyl-coa}}
{{#set: inchi-key=inchikey=czugfkjycpyhhv-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=qaqrevbbadehpa-iexphmlfsa-j}}
{{#set: molecular-weight=106.182}}
+
{{#set: molecular-weight=819.566}}

Revision as of 18:56, 14 January 2021

Metabolite PROPIONYL-COA

  • common-name:
    • propanoyl-coa
  • smiles:
    • ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • qaqrevbbadehpa-iexphmlfsa-j
  • molecular-weight:
    • 819.566

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality