Difference between revisions of "CPD-431"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-137 TRANS-RXN-137] == * direction: ** left-to-right == Reaction formula == * 1 [[NITRITE]...") |
(Created page with "Category:metabolite == Metabolite CPD-431 == * common-name: ** apigenin * smiles: ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3))) * inchi-key: ** kznifhplkgyrtm-u...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-431 == |
| − | * | + | * common-name: |
| − | ** | + | ** apigenin |
| − | + | * smiles: | |
| − | * | + | ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3))) |
| − | == | + | * inchi-key: |
| − | + | ** kznifhplkgyrtm-uhfffaoysa-m | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 269.233 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-7651]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | ** | + | {{#set: common-name=apigenin}} |
| − | + | {{#set: inchi-key=inchikey=kznifhplkgyrtm-uhfffaoysa-m}} | |
| − | + | {{#set: molecular-weight=269.233}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | * | ||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-431
- common-name:
- apigenin
- smiles:
- c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3)))
- inchi-key:
- kznifhplkgyrtm-uhfffaoysa-m
- molecular-weight:
- 269.233
