Difference between revisions of "CPD-431"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-137 TRANS-RXN-137] == * direction: ** left-to-right == Reaction formula == * 1 [[NITRITE]...") |
(Created page with "Category:metabolite == Metabolite CPD-14202 == * common-name: ** l-erythro-7,8-dihydrobiopterin * smiles: ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) * inchi-key: ** femxzdut...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-14202 == |
| − | * | + | * common-name: |
| − | ** | + | ** l-erythro-7,8-dihydrobiopterin |
| − | + | * smiles: | |
| − | * | + | ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) |
| − | == | + | * inchi-key: |
| − | + | ** femxzdutfrtwpe-dzswipipsa-n | |
| − | + | * molecular-weight: | |
| − | + | ** 239.233 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | + | * [[SEPIAPTERIN-REDUCTASE-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | ** | + | * [[RXN-7908]] |
| − | * | + | * [[SEPIAPTERIN-REDUCTASE-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | ** | + | {{#set: common-name=l-erythro-7,8-dihydrobiopterin}} |
| − | + | {{#set: inchi-key=inchikey=femxzdutfrtwpe-dzswipipsa-n}} | |
| − | + | {{#set: molecular-weight=239.233}} | |
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | * | ||
| − | == | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:36, 18 December 2020
Contents
Metabolite CPD-14202
- common-name:
- l-erythro-7,8-dihydrobiopterin
- smiles:
- cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n))
- inchi-key:
- femxzdutfrtwpe-dzswipipsa-n
- molecular-weight:
- 239.233
