Difference between revisions of "CPD-444"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20687 == * transcription-direction: ** positive * right-end-position: ** 170095 * left-end-position: ** 144403 * centisome-position: ** 70.51685...") |
(Created page with "Category:metabolite == Metabolite CPD-444 == * common-name: ** s-(methyl-5-thio-α-d-ribose 1-phosphate * smiles: ** cscc1(oc(op([o-])(=o)[o-])c(c1o)o) * inchi-key: *...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-444 == |
− | * | + | * common-name: |
− | ** | + | ** s-(methyl-5-thio-α-d-ribose 1-phosphate |
− | * | + | * smiles: |
− | ** | + | ** cscc1(oc(op([o-])(=o)[o-])c(c1o)o) |
− | * | + | * inchi-key: |
− | ** | + | ** jtfittqbrjdstl-kvtdhhqdsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 258.182 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[5.3.1.23-RXN]] |
− | == Reaction(s) | + | * [[M5TRPI]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[M5TAP]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=s-(methyl-5-thio-α-d-ribose 1-phosphate}} |
− | + | {{#set: inchi-key=inchikey=jtfittqbrjdstl-kvtdhhqdsa-l}} | |
− | + | {{#set: molecular-weight=258.182}} | |
− | {{#set: | ||
− | {{#set: | ||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-444
- common-name:
- s-(methyl-5-thio-α-d-ribose 1-phosphate
- smiles:
- cscc1(oc(op([o-])(=o)[o-])c(c1o)o)
- inchi-key:
- jtfittqbrjdstl-kvtdhhqdsa-l
- molecular-weight:
- 258.182