Difference between revisions of "CPD-444"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15637 == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
(Created page with "Category:metabolite == Metabolite NN-DIMETHYLANILINE == * common-name: ** n,n-dimethylaniline * smiles: ** cn(c1(c=cc=cc=1))c * inchi-key: ** jltdjthdqawbav-uhfffaoysa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15637 ==
+
== Metabolite NN-DIMETHYLANILINE ==
 
* common-name:
 
* common-name:
** 6-cis-tridecenoyl-coa
+
** n,n-dimethylaniline
 
* smiles:
 
* smiles:
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cn(c1(c=cc=cc=1))c
 
* inchi-key:
 
* inchi-key:
** uuivzebypbpkll-dxazuofzsa-j
+
** jltdjthdqawbav-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 957.819
+
** 121.182
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14771]]
+
* [[1.14.13.8-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-cis-tridecenoyl-coa}}
+
{{#set: common-name=n,n-dimethylaniline}}
{{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}}
+
{{#set: inchi-key=inchikey=jltdjthdqawbav-uhfffaoysa-n}}
{{#set: molecular-weight=957.819}}
+
{{#set: molecular-weight=121.182}}

Revision as of 14:53, 5 January 2021

Metabolite NN-DIMETHYLANILINE

  • common-name:
    • n,n-dimethylaniline
  • smiles:
    • cn(c1(c=cc=cc=1))c
  • inchi-key:
    • jltdjthdqawbav-uhfffaoysa-n
  • molecular-weight:
    • 121.182

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality