Difference between revisions of "CPD-444"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NN-DIMETHYLANILINE == * common-name: ** n,n-dimethylaniline * smiles: ** cn(c1(c=cc=cc=1))c * inchi-key: ** jltdjthdqawbav-uhfffaoysa-n *...") |
(Created page with "Category:metabolite == Metabolite CPD0-2472 == * common-name: ** (r)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-2472 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-nadhx |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** idbzkgqrlbfufq-mtkbybfrsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 681.445 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12752]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-nadhx}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=idbzkgqrlbfufq-mtkbybfrsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=681.445}} |
Revision as of 15:24, 5 January 2021
Contents
Metabolite CPD0-2472
- common-name:
- (r)-nadhx
- smiles:
- c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
- inchi-key:
- idbzkgqrlbfufq-mtkbybfrsa-l
- molecular-weight:
- 681.445
