Difference between revisions of "CPD-444"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20687 == * transcription-direction: ** positive * right-end-position: ** 170095 * left-end-position: ** 144403 * centisome-position: ** 70.51685...") |
(Created page with "Category:metabolite == Metabolite CPD-15637 == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15637 == |
− | * | + | * common-name: |
− | ** | + | ** 6-cis-tridecenoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** uuivzebypbpkll-dxazuofzsa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 957.819 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14771]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=6-cis-tridecenoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}} | |
− | {{#set: | + | {{#set: molecular-weight=957.819}} |
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Revision as of 20:29, 18 December 2020
Contents
Metabolite CPD-15637
- common-name:
- 6-cis-tridecenoyl-coa
- smiles:
- ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- uuivzebypbpkll-dxazuofzsa-j
- molecular-weight:
- 957.819