Difference between revisions of "CPD-4441"

Revision as of 08:30, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15425 ==
+== Metabolite DELTA3-ISOPENTENYL-PP ==
 * common-name:
-** 6''-o-carbamoylkanamycin a
+** isopentenyl diphosphate
 * smiles:
-** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
+** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
 * inchi-key:
-** prwqrpnqdikfbr-noamyhissa-r
+** nuhsrofqtuxzqq-uhfffaoysa-k
 * molecular-weight:
-** 531.559
+** 243.069
 == Reaction(s) known to consume the compound ==
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
+* [[FPPS]]
+* [[FPPSYN-RXN]]
+* [[GGPS]]
+* [[GPPS]]
+* [[GPPSYN-RXN]]
+* [[IDI]]
+* [[IPPISOM-RXN]]
+* [[RXN-10068]]
+* [[RXN-11486]]
+* [[RXN-11488]]
+* [[RXN-11963]]
+* [[RXN-8999]]
+* [[RXN-9969]]
+* [[RXN0-5180]]
+* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13167]]
+* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
-* [[RXN-15285]]
+* [[GPPSYN-RXN]]
+* [[IDS1]]
+* [[IPPISOM-RXN]]
+* [[ISPH2-RXN]]
+* [[RXN-10068]]
+* [[RXN-11963]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6''-o-carbamoylkanamycin a}}
+{{#set: common-name=isopentenyl diphosphate}}
-{{#set: inchi-key=inchikey=prwqrpnqdikfbr-noamyhissa-r}}
+{{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}}
-{{#set: molecular-weight=531.559}}
+{{#set: molecular-weight=243.069}}