Difference between revisions of "CPD-4441"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15425 == * common-name: ** 6''-o-carbamoylkanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o...") |
(Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * smiles: ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) * inchi-key: ** uzkqtcbamswpjd-uqcoibpssa-n * mol...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-4441 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cis-zeatin |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uzkqtcbamswpjd-uqcoibpssa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 219.246 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-4733]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cis-zeatin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=219.246}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-4441
- common-name:
- cis-zeatin
- smiles:
- cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
- inchi-key:
- uzkqtcbamswpjd-uqcoibpssa-n
- molecular-weight:
- 219.246
