Difference between revisions of "CPD-4441"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERTRANSAMPYR-RXN PSERTRANSAMPYR-RXN] == * direction: ** reversible * ec-number: ** [http://enzyme...")
 
(Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * smiles: ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) * inchi-key: ** uzkqtcbamswpjd-uqcoibpssa-n * mol...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERTRANSAMPYR-RXN PSERTRANSAMPYR-RXN] ==
+
== Metabolite CPD-4441 ==
−
* direction:
+
* common-name:
−
** reversible
+
** cis-zeatin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.6.1.52 ec-2.6.1.52]
+
** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[3OH-4P-OH-ALPHA-KETOBUTYRATE]][c] '''+''' 1 [[GLT]][c] '''<=>''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[4-PHOSPHONOOXY-THREONINE]][c]
+
** uzkqtcbamswpjd-uqcoibpssa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ02143]]
+
** 219.246
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-4733]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PYRIDOXSYN-PWY]], pyridoxal 5'-phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXSYN-PWY PYRIDOXSYN-PWY]
+
== Reaction(s) of unknown directionality ==
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
{{#set: common-name=cis-zeatin}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=219.246}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16576 16576]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R05085 R05085]
 
−
{{#set: direction=reversible}}
 
−
{{#set: ec-number=ec-2.6.1.52}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-4441

  • common-name:
    • cis-zeatin
  • smiles:
    • cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
  • inchi-key:
    • uzkqtcbamswpjd-uqcoibpssa-n
  • molecular-weight:
    • 219.246

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4441&oldid=139056"