Difference between revisions of "CPD-4441"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDRm GDRm] == * direction: ** left-to-right * common-name: ** glutathione-disulfide reductase, mito...")
(Created page with "Category:metabolite == Metabolite ARG == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-key: ** odksfydxxfifqn-bypyzucnsa-o * molecular-...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDRm GDRm] ==
+
== Metabolite ARG ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** glutathione-disulfide reductase, mitochondria
+
** l-arginine
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[NADH]][m] '''+''' 1.0 [[OXIDIZED-GLUTATHIONE]][m] '''+''' 1.0 [[PROTON]][m] '''=>''' 2.0 [[GLUTATHIONE]][m] '''+''' 1.0 [[NAD]][m]
+
** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ17355]]
+
** odksfydxxfifqn-bypyzucnsa-o
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 175.21
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[1.5.1.11-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[1.5.1.19-RXN]]
−
== External links  ==
+
* [[ARG-OXIDATION-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[ARGDECARBOX-RXN]]
−
{{#set: common-name=glutathione-disulfide reductase, mitochondria}}
+
* [[ARGINASE-RXN]]
−
{{#set: nb gene associated=1}}
+
* [[ARGININE--TRNA-LIGASE-RXN]]
−
{{#set: nb pathway associated=0}}
+
* [[ARGSUCCINLYA-RXN]]
−
{{#set: reconstruction category=orthology}}
+
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
−
{{#set: reconstruction tool=pantograph}}
+
* [[RXN-13564]]
−
{{#set: reconstruction comment=n.a}}
+
* [[biomass_rxn]]
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
== Reaction(s) known to produce the compound ==
 +
* [[ARGDECARBOX-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ARGSUCCINLYA-RXN]]
 +
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=l-arginine}}
 +
{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}
 +
{{#set: molecular-weight=175.21}}

Revision as of 20:36, 18 December 2020

Metabolite ARG

  • common-name:
    • l-arginine
  • smiles:
    • c(nc(n)=[n+])ccc([n+])c(=o)[o-]
  • inchi-key:
    • odksfydxxfifqn-bypyzucnsa-o
  • molecular-weight:
    • 175.21

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4441&oldid=47872"