Difference between revisions of "CPD-452"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * smiles: ** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(...")
(Created page with "Category:metabolite == Metabolite R-3-hydroxybehenoyl-ACPs == * common-name: ** a (3r)-3-hydroxybehenoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-36...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOTETRAOSE ==
+
== Metabolite R-3-hydroxybehenoyl-ACPs ==
 
* common-name:
 
* common-name:
** maltotetraose
+
** a (3r)-3-hydroxybehenoyl-[acp]
* smiles:
 
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
 
* inchi-key:
 
** luewuzlmquobsb-ayqjavfrsa-n
 
* molecular-weight:
 
** 666.583
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5182]]
+
* [[RXN1G-363]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYMALTOPHOSPHORYL-RXN]]
+
* [[RXN1G-157]]
* [[RXN-14281]]
+
* [[RXN1G-469]]
* [[RXN-14284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltotetraose}}
+
{{#set: common-name=a (3r)-3-hydroxybehenoyl-[acp]}}
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
 
{{#set: molecular-weight=666.583}}
 

Revision as of 08:28, 15 March 2021

Metabolite R-3-hydroxybehenoyl-ACPs

  • common-name:
    • a (3r)-3-hydroxybehenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxybehenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.